4-Fluoro-2-methyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]aniline structure
|
Common Name | 4-Fluoro-2-methyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 5568-04-7 | Molecular Weight | 304.27300 | |
| Density | 1.427g/cm3 | Boiling Point | 446.6ºC at 760 mmHg | |
| Molecular Formula | C15H13FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.9ºC | |
| Name | 4-Fluoro-2-methyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 446.6ºC at 760 mmHg |
| Molecular Formula | C15H13FN2O4 |
| Molecular Weight | 304.27300 |
| Flash Point | 223.9ºC |
| Exact Mass | 304.08600 |
| PSA | 76.31000 |
| LogP | 3.97930 |
| Index of Refraction | 1.651 |
| InChIKey | POYJOUDYNBXLJO-UHFFFAOYSA-N |
| SMILES | Cc1cc(F)ccc1NCc1cc2c(cc1[N+](=O)[O-])OCO2 |
|
~%
4-Fluoro-2-meth... CAS#:5568-04-7 |
| Literature: Niederl Industrial and Engineering Chemistry, 1938 , vol. 30, p. 1269,1272 |
|
~%
4-Fluoro-2-meth... CAS#:5568-04-7 |
| Literature: Niederl Industrial and Engineering Chemistry, 1938 , vol. 30, p. 1269,1272 |
|
~%
4-Fluoro-2-meth... CAS#:5568-04-7 |
| Literature: Niederl Industrial and Engineering Chemistry, 1938 , vol. 30, p. 1269,1272 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 4-tert-octyl-2,6-bis(hydroxymethyl)phenol |
| 2-Hydroxy-1.3-bis-hydroxymethyl-5-(1.1.3.3-tetramethyl-butyl)-benzol |
| 2,4,6-TRIS(1,1-DIMETHYLPROPYL)PHENOL |
| 2-Hydroxy-1.3.5-tri-tert.-pentyl-benzol |
| 2.4.6-Tri-tert.-pentyl-phenol |
| Phenol,2,4,6-tris(1,1-dimethylpropyl) |
| 2,6-Bis(hydroxymethyl)-4-(1,1,3,3-tetramethylbutyl)phenol |