2,2-Bis(hydroxymethyl)butyl octanoate structure
|
Common Name | 2,2-Bis(hydroxymethyl)butyl octanoate | ||
|---|---|---|---|---|
| CAS Number | 55680-38-1 | Molecular Weight | 260.37000 | |
| Density | 1.008g/cm3 | Boiling Point | 341.2ºC at 760mmHg | |
| Molecular Formula | C14H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.2ºC | |
| Name | 2,2-Bis(hydroxymethyl)butyl octanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.008g/cm3 |
|---|---|
| Boiling Point | 341.2ºC at 760mmHg |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37000 |
| Flash Point | 113.2ºC |
| Exact Mass | 260.19900 |
| PSA | 66.76000 |
| LogP | 2.27110 |
| Index of Refraction | 1.467 |
| InChIKey | VTXXMYYOSSNAFD-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC(CC)(CO)CO |
|
~%
2,2-Bis(hydroxy... CAS#:55680-38-1
Detail
|
| Literature: Pervova; Kirichenko; Gorbunova; Zapevalov; Saloutin Russian Journal of General Chemistry, 2008 , vol. 78, # 9 p. 1701 - 1706 |
|
~%
2,2-Bis(hydroxy... CAS#:55680-38-1 |
| Literature: Tao, Yifeng; Chen, Biqiang; Liu, Luo; Tan, Tianwei Journal of Molecular Catalysis B: Enzymatic, 2012 , vol. 74, # 3-4 p. 151 - 155 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Trimethylolpropane caprylic acidester (1:1) |
| Octanoicacid,ester with trimethylolpropane (7CI) |
| Octanoic acid,2,2-bis(hydroxymethyl)butyl ester |
| trimethylolpropane caprylate |
| EINECS 259-752-5 |