2-Chloro-7-nitroquinoxaline structure
|
Common Name | 2-Chloro-7-nitroquinoxaline | ||
|---|---|---|---|---|
| CAS Number | 55686-94-7 | Molecular Weight | 209.589 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 350.5±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H4ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.8±26.5 °C | |
| Name | 2-Chloro-7-nitroquinoxaline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 350.5±37.0 °C at 760 mmHg |
| Molecular Formula | C8H4ClN3O2 |
| Molecular Weight | 209.589 |
| Flash Point | 165.8±26.5 °C |
| Exact Mass | 208.999207 |
| PSA | 71.60000 |
| LogP | 1.99 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.700 |
| InChIKey | DCWHGXURAAYUEC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2ncc(Cl)nc2c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Quinoxaline, 2-chloro-7-nitro- |
| 2-Chloro-7-nitroquinoxaline |