4-Methoxy-5-methyl-2-nitroaniline structure
|
Common Name | 4-Methoxy-5-methyl-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 55730-09-1 | Molecular Weight | 182.177 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 355.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H10N2O3 | Melting Point | 117.5-118.5°C | |
| MSDS | N/A | Flash Point | 168.5±26.5 °C | |
| Name | 4-Methoxy-5-methyl-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.1±37.0 °C at 760 mmHg |
| Melting Point | 117.5-118.5°C |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.177 |
| Flash Point | 168.5±26.5 °C |
| Exact Mass | 182.069138 |
| PSA | 81.07000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | QRQYCJHQHGNOPP-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(N)cc1C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Methoxy-5-methyl-2-nitroaniline |
| Benzenamine, 4-methoxy-5-methyl-2-nitro- |
| CL8406 |
| 2-Nitro-4-methoxy-5-methylaniline |