3-[(carboxymethylamino)methyl]-4-hydroxybenzoic acid structure
|
Common Name | 3-[(carboxymethylamino)methyl]-4-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 55739-39-4 | Molecular Weight | 225.19800 | |
| Density | 1.47g/cm3 | Boiling Point | 506.3ºC at 760 mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | 220ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 260ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-[(carboxymethylamino)methyl]-4-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 506.3ºC at 760 mmHg |
| Melting Point | 220ºC (dec.)(lit.) |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Flash Point | 260ºC |
| Exact Mass | 225.06400 |
| PSA | 106.86000 |
| LogP | 0.65550 |
| Index of Refraction | 1.628 |
| InChIKey | ZASGCNOMAYYQIX-UHFFFAOYSA-N |
| SMILES | O=C(O)CNCc1cc(C(=O)O)ccc1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Chorismate lyase: kinetics and engineering for stability.
Biochim. Biophys. Acta 1594(1) , 160-7, (2002) By removing the enolpyruvyl group from chorismate, chorismate lyase (CL) produces p-hydroxybenzoate (p-HB) for the ubiquinone biosynthetic pathway. We have analyzed CL by several spectroscopic and che... |
| MFCD00134358 |