2-(2,4,5-trichlorophenoxy)propanoyl chloride structure
|
Common Name | 2-(2,4,5-trichlorophenoxy)propanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 55746-49-1 | Molecular Weight | 287.95500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,4,5-trichlorophenoxy)propanoyl chloride |
|---|
| Molecular Formula | C9H6Cl4O2 |
|---|---|
| Molecular Weight | 287.95500 |
| Exact Mass | 285.91200 |
| PSA | 26.30000 |
| LogP | 4.17950 |
| InChIKey | VQKNUKBYXLCMRF-UHFFFAOYSA-N |
| SMILES | CC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)Cl |
|
~%
2-(2,4,5-trichl... CAS#:55746-49-1 |
| Literature: Krewson et al. Journal of Agricultural and Food Chemistry, 1959 , vol. 7, p. 118,120 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |