Benzoic acid,3,5-dibromo-4-hydroxy-, ethyl ester structure
|
Common Name | Benzoic acid,3,5-dibromo-4-hydroxy-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 55771-81-8 | Molecular Weight | 323.96600 | |
| Density | 1.855g/cm3 | Boiling Point | 312.4ºC at 760mmHg | |
| Molecular Formula | C9H8Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.7ºC | |
| Name | ethyl 3,5-dibromo-4-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.855g/cm3 |
|---|---|
| Boiling Point | 312.4ºC at 760mmHg |
| Molecular Formula | C9H8Br2O3 |
| Molecular Weight | 323.96600 |
| Flash Point | 142.7ºC |
| Exact Mass | 321.88400 |
| PSA | 46.53000 |
| LogP | 3.09390 |
| Index of Refraction | 1.602 |
| InChIKey | RLKDCOVOJVJVFI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Br)c(O)c(Br)c1 |
| Storage condition | 2-8°C |
| HS Code | 2918290000 |
|---|
|
~95%
Benzoic acid,3,... CAS#:55771-81-8 |
| Literature: Kakinami; Suenaga; Yamaguchi; Okamoto; Kajigaeshi Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 10 p. 3373 - 3375 |
|
~%
Benzoic acid,3,... CAS#:55771-81-8 |
| Literature: Robertson Journal of the Chemical Society, 1902 , vol. 81, p. 1480 |
|
~%
Benzoic acid,3,... CAS#:55771-81-8 |
| Literature: Robertson Journal of the Chemical Society, 1902 , vol. 81, p. 1480 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,3,5-dibromo-4-hydroxy-,ethyl ester |
| Ethyl 4-hydroxy-3,5-dibromobenzoate |
| 3,5-Dibrom-4-hydroxy-benzoesaeure-aethylester |
| 3,5-dibromo-4-hydroxy-benzoic acid ethyl ester |
| EINECS 259-805-2 |