2-(4-Chlorophenyl)indolizine-3-carboxaldehyde structure
|
Common Name | 2-(4-Chlorophenyl)indolizine-3-carboxaldehyde | ||
|---|---|---|---|---|
| CAS Number | 558424-57-0 | Molecular Weight | 255.69900 | |
| Density | 1.24g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorophenyl)indolizine-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Molecular Formula | C15H10ClNO |
| Molecular Weight | 255.69900 |
| Exact Mass | 255.04500 |
| PSA | 21.48000 |
| LogP | 4.07220 |
| Index of Refraction | 1.631 |
| InChIKey | BHZHIJDNUJCYFI-UHFFFAOYSA-N |
| SMILES | O=Cc1c(-c2ccc(Cl)cc2)cc2ccccn12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| or1976 |