Phosphoric acid, 4-(1-methylethyl)phenyl diphenyl ester structure
|
Common Name | Phosphoric acid, 4-(1-methylethyl)phenyl diphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 55864-04-5 | Molecular Weight | 368.36300 | |
| Density | 1.196g/cm3 | Boiling Point | 422.4ºC at 760 mmHg | |
| Molecular Formula | C21H21O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.7ºC | |
| Name | diphenyl (4-propan-2-ylphenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 422.4ºC at 760 mmHg |
| Molecular Formula | C21H21O4P |
| Molecular Weight | 368.36300 |
| Flash Point | 222.7ºC |
| Exact Mass | 368.11800 |
| PSA | 54.57000 |
| LogP | 6.45490 |
| Index of Refraction | 1.575 |
| InChIKey | JUHFQCKQQLMGAB-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)cc1 |
| HS Code | 2919900090 |
|---|
|
~%
Phosphoric acid... CAS#:55864-04-5 |
| Literature: Albemarle Corporation Patent: US2012/4438 A1, 2012 ; |
|
~%
Phosphoric acid... CAS#:55864-04-5 |
| Literature: Honkakoski, Paavo; Palvimo, Jorma J.; Penttilae, Leena; Vepsaelaeinen, Jouko; Auriola, Seppo Biochemical Pharmacology, 2004 , vol. 67, # 1 p. 97 - 106 |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| p-Cumenyl phenyl phosphate |
| diphenyl 4-isopropylphenyl phosphate |
| Phosphoric acid,4-(1-methylethyl)phenyl diphenyl ester |
| 4-isopropylphenyl diphenyl phosphate |
| p-isopropylphenyl diphenyl phosphate |
| Diphenyl p-isopropylphenyl phosphate |
| p-Cumenyl phenyl phosphate (7CI) |