3-[[(dimethylamino)methylene]amino]-3-(2,4,6-triiodophenyl)propionic acid structure
|
Common Name | 3-[[(dimethylamino)methylene]amino]-3-(2,4,6-triiodophenyl)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 5587-89-3 | Molecular Weight | 597.95700 | |
| Density | 2.31g/cm3 | Boiling Point | 579.8ºC at 760mmHg | |
| Molecular Formula | C12H13I3N2O2 | Melting Point | 168-169ºC | |
| MSDS | N/A | Flash Point | 304.4ºC | |
| Name | 3-(3-{[(Dimethylamino)methylene]amino}-2,4,6-triiodophenyl)propanoic acid hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 2.31g/cm3 |
|---|---|
| Boiling Point | 579.8ºC at 760mmHg |
| Melting Point | 168-169ºC |
| Molecular Formula | C12H13I3N2O2 |
| Molecular Weight | 597.95700 |
| Flash Point | 304.4ºC |
| Exact Mass | 597.81100 |
| PSA | 52.90000 |
| LogP | 3.73900 |
| Index of Refraction | 1.715 |
| InChIKey | YQNFBOJPTAXAKV-UHFFFAOYSA-N |
| SMILES | CN(C)C=Nc1c(I)cc(I)c(CCC(=O)O)c1I |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2925290090 |
|---|
|
~%
3-[[(dimethylam... CAS#:5587-89-3 |
| Literature: Cassebaum,H.; Dierbach,K. Pharmazie, 1961 , vol. 16, p. 389 - 395 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Antiviral activity against SARS-CoV-2 (USA-WA1/2020 strain) measured by imaging in HR...
Source: ChEMBL
Target: Severe acute respiratory syndrome coronavirus 2
External Id: CHEMBL4303810
|
|
Name: Literature-mined public compounds from Kruhlak et al phospholipidosis modelling datas...
Source: ChEMBL
Target: Phospholipidosis
External Id: CHEMBL1697855
|
|
Name: Enzymatic assay of human HDAC6 with commercial peptide substrate
Source: ChEMBL
Target: Histone deacetylase 6
External Id: CHEMBL4808149
|
|
Name: uHTS identification of small molecule modulators of Rev-erb Alpha.
Source: Burnham Center for Chemical Genomics
Target: N/A
External Id: SBCCG-A1016-RevErbaLBD-Primary-Assay
|
|
Name: Enzymatic assay of human HDAC6 with custom peptide substrate
Source: ChEMBL
Target: Histone deacetylase 6
External Id: CHEMBL4808150
|
|
Name: S16 Schwann cell viability assay (CellTiter-Glo assay)
Source: NCGC
Target: N/A
External Id: cmt-p4-fda-celltiter_regid
|
|
Name: Biochemical firefly luciferase enzyme assay for NPC
Source: NCGC
Target: Luciferase [Photinus pyralis]
External Id: adst-fluc-km-fda-o1_regid
|
|
Name: S16 Schwann cell PMP22 intronic element firefly luciferase assay
Source: NCGC
Target: peripheral myelin protein 22 [Rattus norvegicus]
External Id: cmt-p4-fluc-fda_regid
|
|
Name: qHTS for Inhibitors of Polymerase Kappa
Source: NCGC
Target: DNA polymerase kappa [Homo sapiens]
External Id: PolK100
|
| oragrafin |
| Ipodic acid |
| Iopdate |
| bilopten |
| 3-<2.4.6-Triiod-3-dimethylaminomethylenamino-phenyl>-propionsaeure |
| Ipodat-saeure |
| bilimin acid |