1-chloro-3-(2-nitrophenoxy)propan-2-ol
1-chloro-3-(2-nitrophenoxy)propan-2-ol structure
|
Common Name | 1-chloro-3-(2-nitrophenoxy)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 55883-22-2 | Molecular Weight | 231.63300 | |
| Density | 1.382g/cm3 | Boiling Point | 408.7ºC at 760 mmHg | |
| Molecular Formula | C9H10ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-3-(2-nitrophenoxy)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 408.7ºC at 760 mmHg |
| Molecular Formula | C9H10ClNO4 |
| Molecular Weight | 231.63300 |
| Flash Point | 201ºC |
| Exact Mass | 231.03000 |
| PSA | 75.28000 |
| LogP | 2.09650 |
| Index of Refraction | 1.571 |
| InChIKey | JLWYUYUMWOZWBL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1OCC(O)CCl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-chloro-3-(2-n... CAS#:55883-22-2 |
| Literature: Stephenson Journal of the Chemical Society, 1954 , p. 1571,1575, 1576 Journal of the Chemical Society, 1955 , p. Errata nach S. 4554 |
|
~%
1-chloro-3-(2-n... CAS#:55883-22-2 |
| Literature: Tamagnan; Lu; Gao; Amici; Baldwin; Innis Journal of Labelled Compounds and Radiopharmaceuticals, 1999 , vol. 42, # SUPPL. 1 p. S191-S193 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Chlor-3-(2-nitro-phenoxy)-propan-2-ol |
| 1-chloro-3-(2-nitro-phenoxy)-propan-2-ol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 55883-22-2? |
| A: Chinese name of 55883-22-2 is 55883-22-2. |
| Q: What is the CAS number of 1-chloro-3-(2-nitrophenoxy)propan-2-ol? |
| A: CAS number of 1-chloro-3-(2-nitrophenoxy)propan-2-ol is 55883-22-2. |
| Q: What is the InChIKey of 1-chloro-3-(2-nitrophenoxy)propan-2-ol? |
| A: InChIKey of 1-chloro-3-(2-nitrophenoxy)propan-2-ol is JLWYUYUMWOZWBL-UHFFFAOYSA-N. |
| Q: What English synonyms does 1-chloro-3-(2-nitrophenoxy)propan-2-ol have? |
| A: English synonyms of 1-chloro-3-(2-nitrophenoxy)propan-2-ol: 1-Chlor-3-(2-nitro-phenoxy)-propan-2-ol, 1-chloro-3-(2-nitro-phenoxy)-propan-2-ol. |
| Q: What is the polar surface area (PSA) of 1-chloro-3-(2-nitrophenoxy)propan-2-ol? |
| A: Polar surface area (PSA) of 1-chloro-3-(2-nitrophenoxy)propan-2-ol is 75.28000. |
| Q: What is the molecular formula of 1-chloro-3-(2-nitrophenoxy)propan-2-ol? |
| A: Molecular formula of 1-chloro-3-(2-nitrophenoxy)propan-2-ol is C9H10ClNO4. |
| Q: What is the English name of 1-chloro-3-(2-nitrophenoxy)propan-2-ol? |
| A: The English name of 1-chloro-3-(2-nitrophenoxy)propan-2-ol is 1-chloro-3-(2-nitrophenoxy)propan-2-ol. |
| Q: What is the molecular weight of 1-chloro-3-(2-nitrophenoxy)propan-2-ol? |
| A: Molecular weight of 1-chloro-3-(2-nitrophenoxy)propan-2-ol is 231.63300. |
| Q: What is the boiling point of 1-chloro-3-(2-nitrophenoxy)propan-2-ol? |
| A: Boiling point of 1-chloro-3-(2-nitrophenoxy)propan-2-ol is 408.7ºC at 760 mmHg. |
| Q: What is the LogP of 1-chloro-3-(2-nitrophenoxy)propan-2-ol? |
| A: LogP of 1-chloro-3-(2-nitrophenoxy)propan-2-ol is 2.09650. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |