1-chloro-3-(2-nitrophenoxy)propan-2-ol structure
|
Common Name | 1-chloro-3-(2-nitrophenoxy)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 55883-22-2 | Molecular Weight | 231.63300 | |
| Density | 1.382g/cm3 | Boiling Point | 408.7ºC at 760 mmHg | |
| Molecular Formula | C9H10ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201ºC | |
| Name | 1-chloro-3-(2-nitrophenoxy)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 408.7ºC at 760 mmHg |
| Molecular Formula | C9H10ClNO4 |
| Molecular Weight | 231.63300 |
| Flash Point | 201ºC |
| Exact Mass | 231.03000 |
| PSA | 75.28000 |
| LogP | 2.09650 |
| Index of Refraction | 1.571 |
| InChIKey | JLWYUYUMWOZWBL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1OCC(O)CCl |
|
~%
1-chloro-3-(2-n... CAS#:55883-22-2 |
| Literature: Stephenson Journal of the Chemical Society, 1954 , p. 1571,1575, 1576 Journal of the Chemical Society, 1955 , p. Errata nach S. 4554 |
|
~%
1-chloro-3-(2-n... CAS#:55883-22-2 |
| Literature: Tamagnan; Lu; Gao; Amici; Baldwin; Innis Journal of Labelled Compounds and Radiopharmaceuticals, 1999 , vol. 42, # SUPPL. 1 p. S191-S193 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Chlor-3-(2-nitro-phenoxy)-propan-2-ol |
| 1-chloro-3-(2-nitro-phenoxy)-propan-2-ol |