4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide
4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide structure
|
Common Name | 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 55895-03-9 | Molecular Weight | 226.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11O4P |
|---|---|
| Molecular Weight | 226.16600 |
| Exact Mass | 226.03900 |
| PSA | 54.57000 |
| LogP | 3.47170 |
| InChIKey | OFMPJJBIQPWNNS-UHFFFAOYSA-N |
| SMILES | CC1=C(C)OP(=O)(Oc2ccccc2)O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4,5-dimethyl-2-... CAS#:55895-03-9 |
| Literature: Ramirez,F. et al. Synthesis, 1975 , p. 99 - 100 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:16764-09-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3,2-Dioxaphosphole,4,5-dimethyl-2-phenoxy-,2-oxide |
| Phenyl-acetoinendiolcyclophosphat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide? |
| A: Related upstream materials(CAS) of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide: 55894-94-5;108-95-2. |
| Q: What is the English name of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide? |
| A: The English name of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide is 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide. |
| Q: What English synonyms does 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide have? |
| A: English synonyms of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide: 1,3,2-Dioxaphosphole,4,5-dimethyl-2-phenoxy-,2-oxide, Phenyl-acetoinendiolcyclophosphat. |
| Q: What is the polar surface area (PSA) of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide? |
| A: Polar surface area (PSA) of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide is 54.57000. |
| Q: What is the molecular weight of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide? |
| A: Molecular weight of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide is 226.16600. |
| Q: What is the SMILES notation of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide? |
| A: SMILES notation of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide is CC1=C(C)OP(=O)(Oc2ccccc2)O1. |
| Q: What is the CAS number of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide? |
| A: CAS number of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide is 55895-03-9. |
| Q: What are the downstream products of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide? |
| A: Related downstream products(CAS) of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide: 16764-09-3. |
| Q: What is the Chinese name of 55895-03-9? |
| A: Chinese name of 55895-03-9 is 55895-03-9. |
| Q: What is the molecular formula of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide? |
| A: Molecular formula of 4,5-dimethyl-2-phenoxy-1,3,2λ5-dioxaphosphole 2-oxide is C10H11O4P. |