1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide structure
|
Common Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 559-05-7 | Molecular Weight | 575.24100 | |
| Density | 1.699g/cm3 | Boiling Point | 317.4ºC at 760 mmHg | |
| Molecular Formula | C14H6F17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.699g/cm3 |
|---|---|
| Boiling Point | 317.4ºC at 760 mmHg |
| Molecular Formula | C14H6F17NO2S |
| Molecular Weight | 575.24100 |
| Flash Point | 145.7ºC |
| Exact Mass | 574.98500 |
| PSA | 54.55000 |
| LogP | 7.54900 |
| Index of Refraction | 1.379 |
| InChIKey | URBBAHQFHYXVEH-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
CAS#:307-35-7
CAS#:423-60-9
CAS#:40630-63-5
CAS#:71053-03-7
CAS#:7795-95-1
CAS#:1763-23-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Heptadecafluor-octan-1-sulfonsaeure-anilid |
| 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluoro-N-phenyl-1-octanesulfonamide |
| heptadecafluoro-octane-1-sulfonic acid anilide |
| 1-Octanesulfonamide,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyl |
| N-phenyl perfluorooctanesulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide? |
| A: InChIKey of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide is URBBAHQFHYXVEH-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide? |
| A: Polar surface area (PSA) of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide is 54.55000. |
| Q: What is the Chinese name of 559-05-7? |
| A: Chinese name of 559-05-7 is 559-05-7. |
| Q: What are the upstream materials of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide? |
| A: Related upstream materials(CAS) of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide: 307-35-7;423-60-9;40630-63-5;71053-03-7;7795-95-1;1763-23-1. |
| Q: What is the CAS number of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide? |
| A: CAS number of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide is 559-05-7. |
| Q: What is the English name of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide? |
| A: The English name of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide. |
| Q: What is the LogP of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide? |
| A: LogP of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide is 7.54900. |
| Q: What is the molecular weight of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide? |
| A: Molecular weight of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide is 575.24100. |
| Q: What English synonyms does 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide have? |
| A: English synonyms of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide: Heptadecafluor-octan-1-sulfonsaeure-anilid, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluoro-N-phenyl-1-octanesulfonamide, heptadecafluoro-octane-1-sulfonic acid anilide, 1-Octanesulfonamide,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyl, N-phenyl perfluorooctanesulfonamide. |
| Q: What is the molecular formula of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide? |
| A: Molecular formula of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-phenyloctane-1-sulfonamide is C14H6F17NO2S. |