perfluorooctanesulphonyl chloride
perfluorooctanesulphonyl chloride structure
|
Common Name | perfluorooctanesulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 423-60-9 | Molecular Weight | 518.57500 | |
| Density | 1.813g/cm3 | Boiling Point | 188.5ºC at 760mmHg | |
| Molecular Formula | C8ClF17O2S | Melting Point | 36 °C | |
| MSDS | Chinese USA | Flash Point | 67.8ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.813g/cm3 |
|---|---|
| Boiling Point | 188.5ºC at 760mmHg |
| Melting Point | 36 °C |
| Molecular Formula | C8ClF17O2S |
| Molecular Weight | 518.57500 |
| Flash Point | 67.8ºC |
| Exact Mass | 517.90400 |
| PSA | 42.52000 |
| LogP | 6.60270 |
| Vapour Pressure | 0.825mmHg at 25°C |
| Index of Refraction | 1.308 |
| InChIKey | FJHZKRYJOILIGD-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive;Xi: Irritant; |
| Risk Phrases | R34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2904909090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 4 | |
CAS#:507-63-1
CAS#:149-44-0
CAS#:7446-09-5
CAS#:7782-50-5
CAS#:68555-67-9
CAS#:1763-23-1
CAS#:10026-13-8
CAS#:423-39-2
CAS#:307-35-7
CAS#:7727-37-9
CAS#:559-05-7
CAS#:142-04-1
CAS#:2806-24-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table lists relevant public references with title, journal and publication metadata for this compound.
|
Use of perfluoro groups in nucleophilic 18F-fluorination. Blom E, et al.
J. Labelled Comp. Radiopharm. 53(1) , 24-30, (2010)
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Heptadecafluor-octan-1-sulfonylchlorid |
| n-C8F17SO2Cl |
| perfluorooctylsulfochlorure |
| heptadecafluoro-octane-1-sulfonyl chloride |
| Perfluoro-1-octanesulfonyl chloride |
| Heptadecafluoro-1-octanesulfonyl chloride |
| PERFLUOROOCTANESULPHONYL CHLORIDE |
| perfluorooctane sulfonyl chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride? |
| A: Related downstream products(CAS) of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride: 307-35-7;559-05-7;142-04-1;2806-24-8. |
| Q: What English synonyms does 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride have? |
| A: English synonyms of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride: Heptadecafluor-octan-1-sulfonylchlorid, n-C8F17SO2Cl, perfluorooctylsulfochlorure, heptadecafluoro-octane-1-sulfonyl chloride, Perfluoro-1-octanesulfonyl chloride, Heptadecafluoro-1-octanesulfonyl chloride, PERFLUOROOCTANESULPHONYL CHLORIDE, perfluorooctane sulfonyl chloride. |
| Q: What is the CAS number of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride? |
| A: CAS number of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride is 423-60-9. |
| Q: What is the molecular formula of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride? |
| A: Molecular formula of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride is C8ClF17O2S. |
| Q: What is the polar surface area (PSA) of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride? |
| A: Polar surface area (PSA) of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride is 42.52000. |
| Q: What is the safety information for 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride? |
| A: Safety information for 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride: 26-36/37/39-45. |
| Q: What is the English name of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride? |
| A: The English name of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride. |
| Q: What is the InChIKey of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride? |
| A: InChIKey of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride is FJHZKRYJOILIGD-UHFFFAOYSA-N. |
| Q: What is the boiling point of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride? |
| A: Boiling point of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride is 188.5ºC at 760mmHg. |
| Q: What is the molecular weight of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride? |
| A: Molecular weight of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride is 518.57500. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |