perfluorooctanesulphonyl chloride structure
|
Common Name | perfluorooctanesulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 423-60-9 | Molecular Weight | 518.57500 | |
| Density | 1.813g/cm3 | Boiling Point | 188.5ºC at 760mmHg | |
| Molecular Formula | C8ClF17O2S | Melting Point | 36 °C | |
| MSDS | Chinese USA | Flash Point | 67.8ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.813g/cm3 |
|---|---|
| Boiling Point | 188.5ºC at 760mmHg |
| Melting Point | 36 °C |
| Molecular Formula | C8ClF17O2S |
| Molecular Weight | 518.57500 |
| Flash Point | 67.8ºC |
| Exact Mass | 517.90400 |
| PSA | 42.52000 |
| LogP | 6.60270 |
| Vapour Pressure | 0.825mmHg at 25°C |
| Index of Refraction | 1.308 |
| InChIKey | FJHZKRYJOILIGD-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive;Xi: Irritant; |
| Risk Phrases | R34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2904909090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Use of perfluoro groups in nucleophilic 18F-fluorination. Blom E, et al.
J. Labelled Comp. Radiopharm. 53(1) , 24-30, (2010)
|
| Heptadecafluor-octan-1-sulfonylchlorid |
| n-C8F17SO2Cl |
| perfluorooctylsulfochlorure |
| heptadecafluoro-octane-1-sulfonyl chloride |
| Perfluoro-1-octanesulfonyl chloride |
| Heptadecafluoro-1-octanesulfonyl chloride |
| PERFLUOROOCTANESULPHONYL CHLORIDE |
| perfluorooctane sulfonyl chloride |