(Z)-4-Phenyl-3-nitro-3-buten-2-one structure
|
Common Name | (Z)-4-Phenyl-3-nitro-3-buten-2-one | ||
|---|---|---|---|---|
| CAS Number | 55902-35-7 | Molecular Weight | 191.18300 | |
| Density | 1.193g/cm3 | Boiling Point | 331.2ºC at 760mmHg | |
| Molecular Formula | C10H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.1ºC | |
| Name | 3-nitro-4-phenylbut-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 331.2ºC at 760mmHg |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.18300 |
| Flash Point | 159.1ºC |
| Exact Mass | 191.05800 |
| PSA | 62.89000 |
| LogP | 2.41640 |
| Index of Refraction | 1.555 |
| InChIKey | IESJBWOEMKWHBE-YFHOEESVSA-N |
| SMILES | CC(=O)C=C(c1ccccc1)[N+](=O)[O-] |
|
~69%
(Z)-4-Phenyl-3-... CAS#:55902-35-7 |
| Literature: Marcot, Bernard; Rabaron, Alain; Viel, Claude; Bellec, Christian; Deswarte, Stephane; Maitte, Pierre Canadian Journal of Chemistry, 1981 , vol. 59, p. 1224 - 1234 |
|
~26%
(Z)-4-Phenyl-3-... CAS#:55902-35-7 |
| Literature: Sagitullina; Glizdinskaya; Sagitullin Chemistry of Heterocyclic Compounds, 2005 , vol. 41, # 6 p. 739 - 744 |
|
~21%
(Z)-4-Phenyl-3-... CAS#:55902-35-7 |
| Literature: Blaha, Ivo; Leseticky, Ladislav Collection of Czechoslovak Chemical Communications, 1986 , vol. 51, # 5 p. 1094 - 1099 |
| 1-benzylidine-1-nitropropanone-2 |
| 2-nitro-1-phenylbuten-3-one |
| 2-nitro-1-phenyl-1-buten-3-one |
| 1-benzylidene-1-nitropropan-2-one |
| 3-nitro-4-phenyl-3-buten-2-one |