4-Hydroxyderricin structure
|
Common Name | 4-Hydroxyderricin | ||
|---|---|---|---|---|
| CAS Number | 55912-03-3 | Molecular Weight | 338.39700 | |
| Density | 1.181g/cm3 | Boiling Point | 542ºC at 760mmHg | |
| Molecular Formula | C21H22O4 | Melting Point | 136-137℃ | |
| MSDS | N/A | Flash Point | 190.8ºC | |
Use of 4-Hydroxyderricin4-Hydroxyderricin, the major active ingredients of Angelica keiskei Koidzumi, is a potent selective MAO-B (Monoamine oxidase inhibitors) inhibitor with an IC50 of 3.43 μM. 4-Hydroxyderricin also mildly inhibits DBH (dopamine β-hydroxylase) activity. 4-Hydroxyderricin has antidepressant activity[1]. |
| Name | (E)-1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Hydroxyderricin, the major active ingredients of Angelica keiskei Koidzumi, is a potent selective MAO-B (Monoamine oxidase inhibitors) inhibitor with an IC50 of 3.43 μM. 4-Hydroxyderricin also mildly inhibits DBH (dopamine β-hydroxylase) activity. 4-Hydroxyderricin has antidepressant activity[1]. |
|---|---|
| Target |
IC50: 3.43 μM (MAO-B)[1] |
| References |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 542ºC at 760mmHg |
| Melting Point | 136-137℃ |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.39700 |
| Flash Point | 190.8ºC |
| Exact Mass | 338.15200 |
| PSA | 66.76000 |
| LogP | 4.51120 |
| Index of Refraction | 1.622 |
| InChIKey | XDKYBPGIBVMHHB-KPKJPENVSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2ccc(O)cc2)c(O)c1CC=C(C)C |
| Storage condition | 2-8℃ |
| HMS2195D24 |
| 4-Hydroxydervicin |
| 4-hydroxyionchocarpin |
| 4-Hydroxyderricin |