ethyl 2-bromo-3-oxo-3-phenylpropanoate structure
|
Common Name | ethyl 2-bromo-3-oxo-3-phenylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 55919-47-6 | Molecular Weight | 271.10700 | |
| Density | 1.445 g/cm3 | Boiling Point | 300.4ºC at 760 mmHg | |
| Molecular Formula | C11H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-bromo-3-oxo-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.445 g/cm3 |
|---|---|
| Boiling Point | 300.4ºC at 760 mmHg |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.10700 |
| Exact Mass | 269.98900 |
| PSA | 43.37000 |
| LogP | 2.19590 |
| Index of Refraction | 1.548 |
| InChIKey | LYOCLQBWSNCBBN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Br)C(=O)c1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
|
~97%
ethyl 2-bromo-3... CAS#:55919-47-6 |
| Literature: Kirihara, Masayuki; Ogawa, Shiho; Noguchi, Takuya; Okubo, Kumiko; Monma, Yoshinari; Shimizu, Ikuko; Shimosaki, Ryuji; Hatano, Akihiko; Hirai, Yoshiro Synlett, 2006 , # 14 p. 2287 - 2289 |
|
~94%
ethyl 2-bromo-3... CAS#:55919-47-6 |
| Literature: Meshram; Reddy; Sadashiv; Yadav Tetrahedron Letters, 2005 , vol. 46, # 4 p. 623 - 626 |
|
~87%
ethyl 2-bromo-3... CAS#:55919-47-6 |
| Literature: Jeyakumar, Kandasamy; Chand, Dillip Kumar Synthesis, 2009 , # 2 p. 306 - 310 |
|
~87%
ethyl 2-bromo-3... CAS#:55919-47-6 |
| Literature: Tetrahedron Letters, , vol. 53, # 2 p. 191 - 195 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethylbromooxophenylpropanoate |
| ethyl 2-bromo-2-benzoylacetate |
| PhCOCHBrCOOEt |
| ethyl 2-bromo-3-oxo-3-phenylpropionate |
| ethyl 2-bromo-3-phenyl-3-oxopropanoate |
| 2-bromoethylbenzoacetate |