amantadine-N-mustard structure
|
Common Name | amantadine-N-mustard | ||
|---|---|---|---|---|
| CAS Number | 5592-71-2 | Molecular Weight | 276.24500 | |
| Density | 1.17g/cm3 | Boiling Point | 305.7ºC at 760mmHg | |
| Molecular Formula | C14H23Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.7ºC | |
| Name | N,N-bis(2-chloroethyl)adamantan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 305.7ºC at 760mmHg |
| Molecular Formula | C14H23Cl2N |
| Molecular Weight | 276.24500 |
| Flash Point | 138.7ºC |
| Exact Mass | 275.12100 |
| PSA | 3.24000 |
| LogP | 3.73480 |
| InChIKey | XXLZNPXWCIMLFS-UHFFFAOYSA-N |
| SMILES | ClCCN(CCCl)C12CC3CC(CC(C3)C1)C2 |
|
~%
amantadine-N-mustard CAS#:5592-71-2 |
| Literature: Aldrich; Hermann; Meier; Paulshock; Prichard; Snyder; Watts Journal of medicinal chemistry, 1971 , vol. 14, # 6 p. 535 - 543 |
|
~%
amantadine-N-mustard CAS#:5592-71-2 |
| Literature: Aldrich; Hermann; Meier; Paulshock; Prichard; Snyder; Watts Journal of medicinal chemistry, 1971 , vol. 14, # 6 p. 535 - 543 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Amantadine-N-mustard |
| <1>Adamantyl-bis-<2-chlor-ethyl>-amin |