2-[(Benzothiazol-2-yl)azo]-5-(diethylamino)phenol structure
|
Common Name | 2-[(Benzothiazol-2-yl)azo]-5-(diethylamino)phenol | ||
|---|---|---|---|---|
| CAS Number | 55939-25-8 | Molecular Weight | 326.41600 | |
| Density | 1.277g/cm3 | Boiling Point | 525.621ºC at 760 mmHg | |
| Molecular Formula | C17H18N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.686ºC | |
| Name | (6E)-6-(1,3-benzothiazol-2-ylhydrazinylidene)-3-(diethylamino)cyclohexa-2,4-dien-1-one |
|---|
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 525.621ºC at 760 mmHg |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.41600 |
| Flash Point | 271.686ºC |
| Exact Mass | 326.12000 |
| PSA | 85.83000 |
| LogP | 3.50180 |
| Index of Refraction | 1.662 |
| InChIKey | ZBJKHKZRHLGTPR-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(N=Nc2nc3ccccc3s2)c(O)c1 |
|
~75%
2-[(Benzothiazo... CAS#:55939-25-8 |
| Literature: Tao, Tao; Xu, Feng; Chen, Xiao-Chun; Liu, Qian-Qian; Huang, Wei; You, Xiao-Zeng Dyes and Pigments, 2012 , vol. 92, # 3 p. 916 - 922 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |