2-benzylidene-3,3-dimethyl-inden-1-one structure
|
Common Name | 2-benzylidene-3,3-dimethyl-inden-1-one | ||
|---|---|---|---|---|
| CAS Number | 55953-72-5 | Molecular Weight | 248.31900 | |
| Density | 1.122g/cm3 | Boiling Point | 394.2ºC at 760 mmHg | |
| Molecular Formula | C18H16O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.1ºC | |
| Name | 2-benzylidene-3,3-dimethylinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 394.2ºC at 760 mmHg |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.31900 |
| Flash Point | 172.1ºC |
| Exact Mass | 248.12000 |
| PSA | 17.07000 |
| LogP | 4.24410 |
| Index of Refraction | 1.628 |
| InChIKey | KGQHTMOZOPSKTH-FOWTUZBSSA-N |
| SMILES | CC1(C)C(=Cc2ccccc2)C(=O)c2ccccc21 |
|
~%
2-benzylidene-3... CAS#:55953-72-5 |
| Literature: Campbell,N. et al. Journal of the Chemical Society, 1963 , p. 993 - 998 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3-dimethyl-2,6-diphenyl-3,4-dihydro-2H-pyran |