Ophiobolin B structure
|
Common Name | Ophiobolin B | ||
|---|---|---|---|---|
| CAS Number | 5601-74-1 | Molecular Weight | 402.56700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ophiobolin BOphiobolin B, a sesterterpene metabolite of Helminthosporium oryzae, inhibits proton extrusion from maize coleoptiles. Ophiobolin B inhibits fusicoccin (FC) promoted proton extrusion, potassium uptake and cell enlargement[1]. The MIC values with the antifungal effect of Ophiobolins B on different zygomycetes is 25–50 μg/mL[2]. |
| Name | Ophiobolin B |
|---|---|
| Synonym | More Synonyms |
| Description | Ophiobolin B, a sesterterpene metabolite of Helminthosporium oryzae, inhibits proton extrusion from maize coleoptiles. Ophiobolin B inhibits fusicoccin (FC) promoted proton extrusion, potassium uptake and cell enlargement[1]. The MIC values with the antifungal effect of Ophiobolins B on different zygomycetes is 25–50 μg/mL[2]. |
|---|---|
| Related Catalog | |
| Target |
Fungal[2] |
| References |
| Molecular Formula | C25H38O4 |
|---|---|
| Molecular Weight | 402.56700 |
| Exact Mass | 402.27700 |
| PSA | 74.60000 |
| LogP | 4.39160 |
| InChIKey | SXRLPRKYTRWOES-PCQMDVLKSA-N |
| SMILES | CC(C)=CCCC(C)C1(O)CCC2(C)CC3C(C(=O)CC3(C)O)C(C=O)=CCC21 |
| 3,14-Dihydroxy-5-oxoophiobola-7,19-dien-25-al |
| Cochliobolin B |