6-(4-methylpiperazin-1-yl)sulfonylquinazoline-2,4-diamine structure
|
Common Name | 6-(4-methylpiperazin-1-yl)sulfonylquinazoline-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 56044-10-1 | Molecular Weight | 322.38600 | |
| Density | 1.459g/cm3 | Boiling Point | 620.9ºC at 760 mmHg | |
| Molecular Formula | C13H18N6O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.3ºC | |
| Name | 6-(4-methylpiperazin-1-yl)sulfonylquinazoline-2,4-diamine |
|---|
| Density | 1.459g/cm3 |
|---|---|
| Boiling Point | 620.9ºC at 760 mmHg |
| Molecular Formula | C13H18N6O2S |
| Molecular Weight | 322.38600 |
| Flash Point | 329.3ºC |
| Exact Mass | 322.12100 |
| PSA | 128.28000 |
| LogP | 0.54710 |
| Index of Refraction | 1.693 |
| InChIKey | WJIPXNDWOWNFHN-UHFFFAOYSA-N |
| SMILES | CN1CCN(S(=O)(=O)c2ccc3nc(N)nc(N)c3c2)CC1 |
| HS Code | 2935009090 |
|---|
|
~%
6-(4-methylpipe... CAS#:56044-10-1 |
| Literature: Elslager; Colbry; Davoll; Hutt; Johnson; Werbel Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1740 - 1743 |
|
~41%
6-(4-methylpipe... CAS#:56044-10-1 |
| Literature: Elslager; Colbry; Davoll; Hutt; Johnson; Werbel Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1740 - 1743 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |