4-Amino-3-isobutylpyrimidine-2,6-dione
4-Amino-3-isobutylpyrimidine-2,6-dione structure
|
Common Name | 4-Amino-3-isobutylpyrimidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 56075-75-3 | Molecular Weight | 183.20800 | |
| Density | 1.171g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H13N3O2 | Melting Point | 270-273ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.171g/cm3 |
|---|---|
| Melting Point | 270-273ºC |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.20800 |
| Exact Mass | 183.10100 |
| PSA | 80.88000 |
| LogP | 0.35600 |
| Index of Refraction | 1.517 |
| InChIKey | QTAYOSNLQPIPFG-UHFFFAOYSA-N |
| SMILES | CC(C)Cn1c(N)cc(=O)[nH]c1=O |
| Storage condition | -20°C Freezer |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933599090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 2 | |
CAS#:592-17-6
CAS#:372-09-8
CAS#:105-56-6
CAS#:58481-39-3
CAS#:63908-26-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Amino-1-isobutyluracil |
| 1-isobutyl-6-aminouracil |
| 6-Amino-1-isobutyl-1H-pyrimidin-2,4-dion |
| 4-AMINO-3-ISOBUTYLPYRIMIDINE-2,6-DIONE |
| 6-amino-1-isobutyl-1,3-dihydropyrimidine-2,4-dione |
| 6-amino-1-isobutyl-1H-pyrimidine-2,4-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione? |
| A: CAS number of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione is 56075-75-3. |
| Q: What are the upstream materials of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione? |
| A: Related upstream materials(CAS) of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione: 592-17-6;372-09-8;105-56-6. |
| Q: What is the molecular weight of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione? |
| A: Molecular weight of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione is 183.20800. |
| Q: What is the melting point of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione? |
| A: Melting point of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione is 270-273ºC. |
| Q: What are the downstream products of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione? |
| A: Related downstream products(CAS) of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione: 58481-39-3;63908-26-9. |
| Q: What is the polar surface area (PSA) of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione? |
| A: Polar surface area (PSA) of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione is 80.88000. |
| Q: What English synonyms does 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione have? |
| A: English synonyms of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione: 6-Amino-1-isobutyluracil, 1-isobutyl-6-aminouracil, 6-Amino-1-isobutyl-1H-pyrimidin-2,4-dion, 4-AMINO-3-ISOBUTYLPYRIMIDINE-2,6-DIONE, 6-amino-1-isobutyl-1,3-dihydropyrimidine-2,4-dione, 6-amino-1-isobutyl-1H-pyrimidine-2,4-dione. |
| Q: What are the storage conditions for 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione? |
| A: Storage conditions for 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione: -20°C Freezer. |
| Q: What is the English name of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione? |
| A: The English name of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione is 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione. |
| Q: What is the molecular formula of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione? |
| A: Molecular formula of 6-amino-1-(2-methylpropyl)pyrimidine-2,4-dione is C8H13N3O2. |