1-Methyl-3-isobutyl-4-aminouracil structure
|
Common Name | 1-Methyl-3-isobutyl-4-aminouracil | ||
|---|---|---|---|---|
| CAS Number | 58481-39-3 | Molecular Weight | 197.23400 | |
| Density | 1.15g/cm3 | Boiling Point | 285.5ºC at 760mmHg | |
| Molecular Formula | C9H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.4ºC | |
| Name | 6-amino-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 285.5ºC at 760mmHg |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.23400 |
| Flash Point | 126.4ºC |
| Exact Mass | 197.11600 |
| PSA | 70.02000 |
| LogP | 0.36640 |
| Index of Refraction | 1.521 |
| InChIKey | LWFXPSLZADQSSL-UHFFFAOYSA-N |
| SMILES | CC(C)Cn1c(N)cc(=O)n(C)c1=O |
| HS Code | 2933599090 |
|---|
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-amino-1-isobutyl-3-methyl-1H-pyrimidine-2,4-dione |
| 1-METHYL-3-ISOBUTYL-4-AMINOURACIL |
| 6-Amino-1-isobutyl-3-methyl-1H-pyrimidin-2,4-dion |
| 4-AMINO-3-ISOBUTYL-1-METHYLPYRIMIDINE-2,6-DIONE |