N-Acetylmetoclopramide structure
|
Common Name | N-Acetylmetoclopramide | ||
|---|---|---|---|---|
| CAS Number | 5608-13-9 | Molecular Weight | 341.83300 | |
| Density | 1.184g/cm3 | Boiling Point | 488.1ºC at 760mmHg | |
| Molecular Formula | C16H24ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249ºC | |
| Name | 4-(Acetylamino)-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 488.1ºC at 760mmHg |
| Molecular Formula | C16H24ClN3O3 |
| Molecular Weight | 341.83300 |
| Flash Point | 249ºC |
| Exact Mass | 341.15100 |
| PSA | 77.65000 |
| LogP | 3.60290 |
| Index of Refraction | 1.557 |
| InChIKey | CUDFIXBYMDJBQT-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)c(NC(C)=O)cc1OC |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-Acetylmetoclopramide |
| N-[2-(Diethylamino)ethyl]-2-methoxy-4-acetamido-5-chlorobenzamide |
| Metoclopramide EP Impurity A |