4,4'-bis(dimethylamino)-4''-(methylamino)trityl alcohol structure
|
Common Name | 4,4'-bis(dimethylamino)-4''-(methylamino)trityl alcohol | ||
|---|---|---|---|---|
| CAS Number | 561-41-1 | Molecular Weight | 375.50700 | |
| Density | 1.152g/cm3 | Boiling Point | 575.3ºC at 760mmHg | |
| Molecular Formula | C24H29N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.7ºC | |
| Name | bis[4-(dimethylamino)phenyl]-[4-(methylamino)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 575.3ºC at 760mmHg |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.50700 |
| Flash Point | 301.7ºC |
| Exact Mass | 375.23100 |
| PSA | 38.74000 |
| LogP | 4.21750 |
| Index of Refraction | 1.653 |
| InChIKey | MAGJOSJRYKEYAZ-UHFFFAOYSA-N |
| SMILES | CNc1ccc(C(O)(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| Hazard Codes | Xi |
|---|
|
~%
4,4'-bis(dimeth... CAS#:561-41-1 |
| Literature: Sen Gupta; Mishra; Radha Rani Indian Journal of Chemistry - Section A Inorganic, Physical, Theoretical and Analytical Chemistry, 2000 , vol. 39, # 7 p. 703 - 708 |
|
~%
4,4'-bis(dimeth... CAS#:561-41-1 |
| Literature: Gupta, Susanta K. Sen; Arvind, Udai Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1994 , vol. 33, # 10 p. 998 - 1000 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methylviolett |
| EINECS 209-218-2 |
| p,p'-Dimethylamino-p''-methylamino-triphenylmethanol |