[1R(1alpha,4abeta,4balpha,10aalpha)]-1,2,3,4,4a,4b,5,6,10,10a-decahydro-7-isopropyl-1,4a-dimethylphenanthren-1-carbonyl chloride structure
|
Common Name | [1R(1alpha,4abeta,4balpha,10aalpha)]-1,2,3,4,4a,4b,5,6,10,10a-decahydro-7-isopropyl-1,4a-dimethylphenanthren-1-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 56151-64-5 | Molecular Weight | 320.89700 | |
| Density | 1.07g/cm3 | Boiling Point | 406.3ºC at 760mmHg | |
| Molecular Formula | C20H29ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.5ºC | |
| Name | 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 406.3ºC at 760mmHg |
| Molecular Formula | C20H29ClO |
| Molecular Weight | 320.89700 |
| Flash Point | 252.5ºC |
| Exact Mass | 320.19100 |
| PSA | 17.07000 |
| LogP | 5.88700 |
| Index of Refraction | 1.533 |
| InChIKey | DUUZGQPIIHHAPA-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=CCC3C(C)(C(=O)Cl)CCCC3(C)C2CC1 |
|
~91%
[1R(1alpha,4abe... CAS#:56151-64-5 |
| Literature: Bardyshev Russian Journal of Organic Chemistry, 1999 , vol. 35, # 1 p. 41 - 55 |
| Abietoyl chloride |
| abietic acid chloride |
| 7,13-Abietadien-18-oic acid chloride |
| EINECS 260-024-4 |
| abieta-7,13-dien-18-oyl chloride |