abietic acid structure
|
Common Name | abietic acid | ||
|---|---|---|---|---|
| CAS Number | 514-10-3 | Molecular Weight | 302.451 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 439.5±44.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O2 | Melting Point | 139-142 °C(lit.) | |
| MSDS | N/A | Flash Point | 208.1±23.1 °C | |
Use of abietic acidAbietic acid, a diterpene isolated from Pimenta racemosa var. grissea, possesses antiproliferative, antibacterial, and anti-obesity properties. Abietic acid inhibits lipoxygenase activity for allergy treatment[1][2]. |
| Name | abietic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Abietic acid, a diterpene isolated from Pimenta racemosa var. grissea, possesses antiproliferative, antibacterial, and anti-obesity properties. Abietic acid inhibits lipoxygenase activity for allergy treatment[1][2]. |
|---|---|
| Related Catalog | |
| References |
[1]. Ulusu NN, et al. Abietic acid inhibits lipoxygenase activity. Phytother Res. 2002 Feb;16(1):88-90. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 439.5±44.0 °C at 760 mmHg |
| Melting Point | 139-142 °C(lit.) |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.451 |
| Flash Point | 208.1±23.1 °C |
| Exact Mass | 302.224579 |
| PSA | 37.30000 |
| LogP | 6.51 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | RSWGJHLUYNHPMX-ONCXSQPRSA-N |
| SMILES | CC(C)C1=CC2=CCC3C(C)(C(=O)O)CCCC3(C)C2CC1 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | TP8580000 |
| Hazard Class | 9.0 |
| HS Code | 2916209090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Abietic acid |
| EINECS 208-178-3 |
| 7-isopropyl-1,4a-dimethyl-1,2,3,4,4a,4b,5,6,10,10a-decahydrophenanthrene-1-carboxylic acid |
| 7,13-Abietadien-18-oic acid |
| 1,1-Dimethyl-7-isopropyl-1,2,3,4-tetrahydro-phenanthren |
| Sylvic Acid |
| abieta-7,13-diene-18-oic acid |
| MFCD03423567 |
| simonellite |
| abieta-7,13-dien-18-oic acid |
| 7-Isopropyl-1,1-dimethyl-1,2,3,4-tetrahydro-phenanthren |
| 7-isopropyl-1,1-dimethyl-1,2,3,4-tetrahydro-phenanthrene |