6,6-Dimethyl-5,7-dioxaspiro(2.5)octane-4,8-dione structure
|
Common Name | 6,6-Dimethyl-5,7-dioxaspiro(2.5)octane-4,8-dione | ||
|---|---|---|---|---|
| CAS Number | 5617-70-9 | Molecular Weight | 170.163 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 396.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H10O4 | Melting Point | 63-65 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 215.9±24.4 °C | |
Use of 6,6-Dimethyl-5,7-dioxaspiro(2.5)octane-4,8-dioneSolubility in Methanol:almost transparency |
| Name | Cycl-Isopropylidene Cyclopropane-1,1-Dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 396.8±35.0 °C at 760 mmHg |
| Melting Point | 63-65 °C(lit.) |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.163 |
| Flash Point | 215.9±24.4 °C |
| Exact Mass | 170.057907 |
| PSA | 52.60000 |
| LogP | -1.01 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | AXJVPXNVESYGDT-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(=O)C2(CC2)C(=O)O1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
|
~82%
6,6-Dimethyl-5,... CAS#:5617-70-9 |
| Literature: Toth, Gyoergy; Tamas, Tivadar; Borbely, Ildiko Synthetic Communications, 2002 , vol. 32, # 23 p. 3659 - 3665 |
|
~82%
6,6-Dimethyl-5,... CAS#:5617-70-9 |
| Literature: Zhu, Xuxiang; Gan, Ping Synthetic Communications, 1998 , vol. 28, # 17 p. 3159 - 3162 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,6-Dimethyl-5,7-dioxaspiro(2.5)octane-4,8-dione |
| 5,7-Dioxaspiro[2.5]octane-4,8-dione, 6,6-dimethyl- |
| EINECS 227-044-5 |
| MFCD00042796 |
| 6,6-DIMETHYL-5,7-DIOXASPIRO[2.5]OCTANE-4,8-DIONE |