(2-amino-5-bromophenyl)-(4-methylphenyl)methanone structure
|
Common Name | (2-amino-5-bromophenyl)-(4-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 5621-60-3 | Molecular Weight | 290.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-amino-5-bromophenyl)-(4-methylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12BrNO |
|---|---|
| Molecular Weight | 290.15500 |
| Exact Mass | 289.01000 |
| PSA | 43.09000 |
| LogP | 4.15190 |
| InChIKey | OCHXQKDWNREAJT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2cc(Br)ccc2N)cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Amino-5-brom-4'-methyl-benzophenon |
| 5'-Brom-2'-amino-4-methyl-benzophenon |
| HMS2666C03 |