5-Bromo isatoic anhydride structure
|
Common Name | 5-Bromo isatoic anhydride | ||
|---|---|---|---|---|
| CAS Number | 4692-98-2 | Molecular Weight | 242.026 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H4BrNO3 | Melting Point | 280-285 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 5-Bromoisatoic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Melting Point | 280-285 °C (dec.)(lit.) |
| Molecular Formula | C8H4BrNO3 |
| Molecular Weight | 242.026 |
| Exact Mass | 240.937454 |
| PSA | 63.07000 |
| LogP | 1.68 |
| Index of Refraction | 1.623 |
| InChIKey | DXSMYDSFWCOSFM-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ccc(Br)cc2c(=O)o1 |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H312-H315-H319-H332-H335-H360 |
| Precautionary Statements | P201-P261-P280-P305 + P351 + P338-P308 + P313 |
| Personal Protective Equipment | Eyeshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R61;R20/21;R36/37/38 |
| Safety Phrases | S53-S23-S36/37/39-S45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Bromo-2H-3,1-benzoxazine-2,4(1H)-dione |
| 6-bromo-1H-3,1-benzoxazine-2,4-dione |
| 6-Bromo isatinic anhydride |
| 2H-3,1-Benzoxazine-2,4(1H)-dione, 6-bromo- |
| 6-Bromo-1,2-dihydro-4H-3,1-benzoxazine-2,4-dione |
| MFCD00016921 |
| 5-Bromo isatoic anhydride |