1,3-Benzodioxole,5-bromo-6-(2,3-dibromopropyl)- structure
|
Common Name | 1,3-Benzodioxole,5-bromo-6-(2,3-dibromopropyl)- | ||
|---|---|---|---|---|
| CAS Number | 56312-11-9 | Molecular Weight | 400.88900 | |
| Density | 2.078g/cm3 | Boiling Point | 379.1ºC at 760 mmHg | |
| Molecular Formula | C10H9Br3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.6ºC | |
| Name | 5-bromo-6-(2,3-dibromopropyl)-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.078g/cm3 |
|---|---|
| Boiling Point | 379.1ºC at 760 mmHg |
| Molecular Formula | C10H9Br3O2 |
| Molecular Weight | 400.88900 |
| Flash Point | 155.6ºC |
| Exact Mass | 397.81500 |
| PSA | 18.46000 |
| LogP | 3.87870 |
| Index of Refraction | 1.642 |
| InChIKey | BPTYOHZNQSPECP-UHFFFAOYSA-N |
| SMILES | BrCC(Br)Cc1cc2c(cc1Br)OCO2 |
|
~88%
1,3-Benzodioxol... CAS#:56312-11-9 |
| Literature: Liu, Lilian Kao; Lin, Ching-Shan Journal of the Chinese Chemical Society, 1996 , vol. 43, # 1 p. 61 - 66 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-bromo-6-(2,3-dibromo-propyl)-benzo[1,3]dioxole |
| 1-bromo-2-(2,3-dibromopropyl)-4,5-methylenedioxybenzene |
| 5-Brom-6-(2,3-dibrom-propyl)-benzo[1,3]dioxol |