N-(1,2-diphenylethylideneamino)-2,4-dinitro-aniline structure
|
Common Name | N-(1,2-diphenylethylideneamino)-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 5637-51-4 | Molecular Weight | 376.36500 | |
| Density | 1.3g/cm3 | Boiling Point | 551.3ºC at 760 mmHg | |
| Molecular Formula | C20H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.2ºC | |
| Name | N-[(E)-1,2-diphenylethylideneamino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 551.3ºC at 760 mmHg |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.36500 |
| Flash Point | 287.2ºC |
| Exact Mass | 376.11700 |
| PSA | 116.03000 |
| LogP | 5.68130 |
| Index of Refraction | 1.642 |
| InChIKey | FYIPOPSKOCRNIR-ZBJSNUHESA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=C(Cc2ccccc2)c2ccccc2)c([N+](=O)[O-])c1 |
|
~%
N-(1,2-diphenyl... CAS#:5637-51-4 |
| Literature: Allen; Richmond Journal of Organic Chemistry, 1937 , vol. 2, p. 222,224 |
|
~%
N-(1,2-diphenyl... CAS#:5637-51-4 |
| Literature: Forbes,C.P. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1974 , p. 2346 - 2350 |
| Benzyl-phenylketon-<2,4-Dinitro-phenylhydrazon> |
| deoxybenzoin-(2,4-dinitro-phenylhydrazone) |
| 1,2-diphenylethanone (2,4-dinitrophenyl)hydrazone |
| Desoxybenzoin-(2,4-dinitro-phenylhydrazon) |