Methyl tributyl ammonium chloride structure
|
Common Name | Methyl tributyl ammonium chloride | ||
|---|---|---|---|---|
| CAS Number | 56375-79-2 | Molecular Weight | 235.837 | |
| Density | 0.964 | Boiling Point | 152ºC | |
| Molecular Formula | C13H30ClN | Melting Point | 95-99ºC | |
| MSDS | N/A | Flash Point | 84-85°C/101mm | |
Use of Methyl tributyl ammonium chlorideN,N-Dibutyl-N-methylbutan-1-aminium chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Methyl Tributyl Ammonium Chloride |
|---|---|
| Synonym | More Synonyms |
| Description | N,N-Dibutyl-N-methylbutan-1-aminium chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 0.964 |
|---|---|
| Boiling Point | 152ºC |
| Melting Point | 95-99ºC |
| Molecular Formula | C13H30ClN |
| Molecular Weight | 235.837 |
| Flash Point | 84-85°C/101mm |
| Exact Mass | 235.206680 |
| LogP | 0.83730 |
| Index of Refraction | n20/D 1.4682 |
| InChIKey | IPILPUZVTYHGIL-UHFFFAOYSA-M |
| SMILES | CCCC[N+](C)(CCCC)CCCC.[Cl-] |
| Water Solubility | soluble |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2827101000 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyltri-n-butylammonium chloride, Aliquat 175 (75% aq. soln.) |
| N,N-Dibutyl-N-methyl-1-butanaminium chloride |
| Tributyl(methyl)ammonium chloride |
| MFCD00011847 |
| 1-Butanaminium, N,N-dibutyl-N-methyl-, chloride |
| 1-Butanaminium, N,N-dibutyl-N-methyl-, chloride (1:1) |
| Methyltributylammonium chloride |
| Tri-n-butylmethylammonium chloride |
| EINECS 260-135-8 |
| n,n-dibutyl-n-methylbutan-1-aminium chloride |
| tributylmethylammonium chloride |