D,L-(p-Nitrobenzyl)succinic Acid structure
|
Common Name | D,L-(p-Nitrobenzyl)succinic Acid | ||
|---|---|---|---|---|
| CAS Number | 56416-12-7 | Molecular Weight | 253.20800 | |
| Density | 1.461g/cm3 | Boiling Point | 426.9ºC at 760 mmHg | |
| Molecular Formula | C11H11NO6 | Melting Point | 149-151ºC | |
| MSDS | N/A | Flash Point | 182.9ºC | |
| Name | D,L-(p-Nitrobenzyl)succinic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.461g/cm3 |
|---|---|
| Boiling Point | 426.9ºC at 760 mmHg |
| Melting Point | 149-151ºC |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.20800 |
| Flash Point | 182.9ºC |
| Exact Mass | 253.05900 |
| PSA | 120.42000 |
| LogP | 1.83600 |
| Index of Refraction | 1.6 |
| InChIKey | DYDFGNHHYHDJLU-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(Cc1ccc([N+](=O)[O-])cc1)C(=O)O |
|
~%
D,L-(p-Nitroben... CAS#:56416-12-7 |
| Literature: Journal of the Chemical Society. Perkin transactions 1, , # 9 p. 830 - 841 |
|
~%
D,L-(p-Nitroben... CAS#:56416-12-7 |
| Literature: Journal of the Chemical Society. Perkin transactions 1, , # 9 p. 830 - 841 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| DL-p-Nitrobenzylbernsteinsaeure |
| tyrosylamide |
| Tyrosinamide |
| L-Tyrosine amide |
| L-Tyrosinamide |
| DL-p-hydroxy-phenylalanine amide |
| H-TYR-NH2 |
| L-tyrosine-NH2 |
| p-Nitrobenzylbernsteinsaeure |