Methyl 4-benzyloxy-3-methoxybenzoate structure
|
Common Name | Methyl 4-benzyloxy-3-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 56441-97-5 | Molecular Weight | 272.296 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 400.1±30.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.6±24.6 °C | |
| Name | Methyl 4-(benzyloxy)-3-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 400.1±30.0 °C at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.296 |
| Flash Point | 176.6±24.6 °C |
| Exact Mass | 272.104858 |
| PSA | 44.76000 |
| LogP | 3.72 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | FPGZHXRPIFVQOL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OCc2ccccc2)c(OC)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 3-methoxy-4-phenylmethoxybenzoate |
| Benzoic acid, 3-methoxy-4-(phenylmethoxy)-, methyl ester |
| Methyl 4-(benzyloxy)-3-methoxybenzoate |
| Methyl 4-benzyloxy-3-methoxybenzoate |