3-Chloro-4-(trifluoromethoxy)benzyl alcohol structure
|
Common Name | 3-Chloro-4-(trifluoromethoxy)benzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 56456-48-5 | Molecular Weight | 226.580 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 236.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H6ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.8±25.9 °C | |
| Name | [3-chloro-4-(trifluoromethoxy)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 236.4±35.0 °C at 760 mmHg |
| Molecular Formula | C8H6ClF3O2 |
| Molecular Weight | 226.580 |
| Flash Point | 96.8±25.9 °C |
| Exact Mass | 226.000839 |
| PSA | 29.46000 |
| LogP | 2.53 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | KPYSDIQXFHKDPU-UHFFFAOYSA-N |
| SMILES | OCc1ccc(OC(F)(F)F)c(Cl)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2909499000 |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Benzenemethanol, 3-chloro-4-(trifluoromethoxy)- |
| Q1R CG DOXFFF |
| 3-Chloro-4-(trifluoromethoxy)benzyl alcohol |
| 3-Chloro-4-(trifluoromethoxy)benzenemethanol |
| [3-Chloro-4-(trifluoromethoxy)phenyl]methanol |