7-azoniaspiro[6.6]tridecane,bromide structure
|
Common Name | 7-azoniaspiro[6.6]tridecane,bromide | ||
|---|---|---|---|---|
| CAS Number | 56496-17-4 | Molecular Weight | 262.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-azoniaspiro[6.6]tridecane,bromide |
|---|
| Molecular Formula | C12H24BrN |
|---|---|
| Molecular Weight | 262.23000 |
| Exact Mass | 261.10900 |
| InChIKey | NFLRNJOHCDXCDP-UHFFFAOYSA-M |
| SMILES | C1CCC[N+]2(CC1)CCCCCC2.[Br-] |
|
~%
7-azoniaspiro[6... CAS#:56496-17-4 |
| Literature: Blicke; Hotelling Journal of the American Chemical Society, 1954 , vol. 76, p. 5099,5100 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |