Pregnane-3,20-dione, 11-hydroxy-, (5.alpha.,11.alpha.) structure
|
Common Name | Pregnane-3,20-dione, 11-hydroxy-, (5.alpha.,11.alpha.) | ||
|---|---|---|---|---|
| CAS Number | 565-96-8 | Molecular Weight | 332.47700 | |
| Density | 1.112g/cm3 | Boiling Point | 468.1ºC at 760 mmHg | |
| Molecular Formula | C21H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251ºC | |
| Name | 11.α.-Hydroxyallopregnane-3,20-dione |
|---|
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 468.1ºC at 760 mmHg |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.47700 |
| Flash Point | 251ºC |
| Exact Mass | 332.23500 |
| PSA | 54.37000 |
| LogP | 3.77420 |
| Index of Refraction | 1.532 |
| InChIKey | XHCCPSKYYJBSAA-ZOVJPLRPSA-N |
| SMILES | CC(=O)C1CCC2C3CCC4CC(=O)CCC4(C)C3C(O)CC12C |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|