ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate
ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate structure
|
Common Name | ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 565176-83-2 | Molecular Weight | 268.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate (Chinese name: 3-氟-4-吗啉苯基氨基甲酸乙酯，CAS number: 565176-83-2)，molecular formula: C13H17FN2O3，molecular weight: 268.28400，For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17FN2O3 |
|---|---|
| Molecular Weight | 268.28400 |
| Exact Mass | 268.12200 |
| PSA | 54.29000 |
| LogP | 2.30930 |
| InChIKey | BIWOYYCTPLLAHX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(N2CCOCC2)c(F)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
ethyl N-(3-fluo... CAS#:565176-83-2 |
| Literature: JUBILANT LIFE SCIENCES LIMITED; GUPTA, Ashish, Kumar; SINGH, Shishupal; PANDA, Atulya, Kumar; BISWAS, Sujay; VIR, Dharam Patent: WO2011/114210 A2, 2011 ; Location in patent: Page/Page column 19 ; |
|
~%
ethyl N-(3-fluo... CAS#:565176-83-2 |
| Literature: JUBILANT LIFE SCIENCES LIMITED; GUPTA, Ashish, Kumar; SINGH, Shishupal; PANDA, Atulya, Kumar; BISWAS, Sujay; VIR, Dharam Patent: WO2011/114210 A2, 2011 ; |
|
~%
ethyl N-(3-fluo... CAS#:565176-83-2 |
| Literature: JUBILANT LIFE SCIENCES LIMITED; GUPTA, Ashish, Kumar; SINGH, Shishupal; PANDA, Atulya, Kumar; BISWAS, Sujay; VIR, Dharam Patent: WO2011/114210 A2, 2011 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 5 | |
CAS#:168828-82-8
CAS#:168828-90-8
CAS#:165800-03-3![(R)-5-(Azidomethyl)-3-[3-fluoro-4-(4-morpholinyl)phenyl]-2-oxazolidinone structure](https://image.chemsrc.com/caspic/481/168828-84-0.png)
CAS#:168828-84-0
CAS#:174649-09-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-carboethoxy-3-fluoro-4-morpholinylaniline |
| ethyl 3-fluoro-4-morpholinophenylcarbamate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate? |
| A: SMILES notation of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate is CCOC(=O)Nc1ccc(N2CCOCC2)c(F)c1. |
| Q: What is the polar surface area (PSA) of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate? |
| A: Polar surface area (PSA) of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate is 54.29000. |
| Q: What is the molecular weight of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate? |
| A: Molecular weight of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate is 268.28400. |
| Q: What is the CAS number of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate? |
| A: CAS number of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate is 565176-83-2. |
| Q: What is the English name of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate? |
| A: The English name of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate is ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate. |
| Q: What is the InChIKey of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate? |
| A: InChIKey of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate is BIWOYYCTPLLAHX-UHFFFAOYSA-N. |
| Q: What are the upstream materials of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate? |
| A: Related upstream materials(CAS) of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate: 541-41-3;93246-53-8;369-34-6;2689-39-6. |
| Q: What English synonyms does ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate have? |
| A: English synonyms of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate: N-carboethoxy-3-fluoro-4-morpholinylaniline, ethyl 3-fluoro-4-morpholinophenylcarbamate. |
| Q: What are the downstream products of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate? |
| A: Related downstream products(CAS) of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate: 168828-82-8;168828-90-8;165800-03-3;168828-84-0;174649-09-3. |
| Q: What is the molecular formula of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate? |
| A: Molecular formula of ethyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate is C13H17FN2O3. |