Silane,1,1'-ethenylidenebis[1,1,1-trimethyl
Silane,1,1'-ethenylidenebis[1,1,1-trimethyl structure
|
Common Name | Silane,1,1'-ethenylidenebis[1,1,1-trimethyl | ||
|---|---|---|---|---|
| CAS Number | 5654-07-9 | Molecular Weight | 172.41500 | |
| Density | 0.759g/cm3 | Boiling Point | 138.4ºC at 760mmHg | |
| Molecular Formula | C8H20Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 19ºC | |
Summary: Silane,1,1'-ethenylidenebis[1,1,1-trimethyl-] (CAS号：5654-07-9) is a compound with molecular formula C8H20Si2 and molecular weight 172.41500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl(1-trimethylsilylethenyl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.759g/cm3 |
|---|---|
| Boiling Point | 138.4ºC at 760mmHg |
| Molecular Formula | C8H20Si2 |
| Molecular Weight | 172.41500 |
| Flash Point | 19ºC |
| Exact Mass | 172.11000 |
| LogP | 3.29740 |
| Index of Refraction | 1.409 |
| InChIKey | CVCQWLSMIOKNLE-UHFFFAOYSA-N |
| SMILES | C=C([Si](C)(C)C)[Si](C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 4 | |
CAS#:29954-86-7
CAS#:917-64-6![ethenyl-[2-[ethenyl(dimethyl)silyl]oxyethoxy]-dimethylsilane Structure](https://image.chemsrc.com/caspic/057/824985-51-5.png)
CAS#:824985-51-5
CAS#:754-05-2
CAS#:824985-52-6
CAS#:78375-53-8
CAS#:29955-10-0
CAS#:78375-52-7![N-[2,2-bis(trimethylsilyl)ethyl]dimethylamine Structure](https://image.chemsrc.com/caspic/477/125069-55-8.png)
CAS#:125069-55-8
CAS#:13683-41-5
CAS#:18415-23-1
CAS#:51666-95-6
CAS#:51666-97-8This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1-Bis-trimethylsilyl-aethen |
| Hexa-Si-methyl-Si,Si'-vinyliden-bis-silan |
| hexa-Si-methyl-Si,Si'-vinylidene-bis-silane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does trimethyl(1-trimethylsilylethenyl)silane have? |
| A: English synonyms of trimethyl(1-trimethylsilylethenyl)silane: 1,1-Bis-trimethylsilyl-aethen, Hexa-Si-methyl-Si,Si'-vinyliden-bis-silan, hexa-Si-methyl-Si,Si'-vinylidene-bis-silane. |
| Q: What is the Chinese name of 5654-07-9? |
| A: Chinese name of 5654-07-9 is 5654-07-9. |
| Q: What is the LogP of trimethyl(1-trimethylsilylethenyl)silane? |
| A: LogP of trimethyl(1-trimethylsilylethenyl)silane is 3.29740. |
| Q: What is the molecular weight of trimethyl(1-trimethylsilylethenyl)silane? |
| A: Molecular weight of trimethyl(1-trimethylsilylethenyl)silane is 172.41500. |
| Q: What are the upstream materials of trimethyl(1-trimethylsilylethenyl)silane? |
| A: Related upstream materials(CAS) of trimethyl(1-trimethylsilylethenyl)silane: 29954-86-7;917-64-6;824985-51-5;754-05-2;824985-52-6;78375-53-8;29955-10-0;78375-52-7;125069-55-8. |
| Q: What are the downstream products of trimethyl(1-trimethylsilylethenyl)silane? |
| A: Related downstream products(CAS) of trimethyl(1-trimethylsilylethenyl)silane: 13683-41-5;18415-23-1;51666-95-6;51666-97-8. |
| Q: What is the InChIKey of trimethyl(1-trimethylsilylethenyl)silane? |
| A: InChIKey of trimethyl(1-trimethylsilylethenyl)silane is CVCQWLSMIOKNLE-UHFFFAOYSA-N. |
| Q: What is the boiling point of trimethyl(1-trimethylsilylethenyl)silane? |
| A: Boiling point of trimethyl(1-trimethylsilylethenyl)silane is 138.4ºC at 760mmHg. |
| Q: What is the SMILES notation of trimethyl(1-trimethylsilylethenyl)silane? |
| A: SMILES notation of trimethyl(1-trimethylsilylethenyl)silane is C=C([Si](C)(C)C)[Si](C)(C)C. |
| Q: What is the molecular formula of trimethyl(1-trimethylsilylethenyl)silane? |
| A: Molecular formula of trimethyl(1-trimethylsilylethenyl)silane is C8H20Si2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |