Silane, (phenylethenylidene)bis(trimethyl- structure
|
Common Name | Silane, (phenylethenylidene)bis(trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 18415-23-1 | Molecular Weight | 248.51100 | |
| Density | 0.874g/cm3 | Boiling Point | 261.2ºC at 760mmHg | |
| Molecular Formula | C14H24Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.4ºC | |
| Name | trimethyl-(2-phenyl-1-trimethylsilylethenyl)silane |
|---|
| Density | 0.874g/cm3 |
|---|---|
| Boiling Point | 261.2ºC at 760mmHg |
| Molecular Formula | C14H24Si2 |
| Molecular Weight | 248.51100 |
| Flash Point | 93.4ºC |
| Exact Mass | 248.14200 |
| LogP | 4.82480 |
| Vapour Pressure | 0.019mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | ULXDRKKYNAWJLU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(=Cc1ccccc1)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |