Benzenesulfonamide, 4-[(aminocarbonyl)amino]
![Benzenesulfonamide, 4-[(aminocarbonyl)amino] Structure](https://image.chemsrc.com/caspic/302/5657-41-0.png)
Benzenesulfonamide, 4-[(aminocarbonyl)amino] structure
|
Common Name | Benzenesulfonamide, 4-[(aminocarbonyl)amino] | ||
|---|---|---|---|---|
| CAS Number | 5657-41-0 | Molecular Weight | 215.23000 | |
| Density | 1.552g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H9N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-sulfamoylphenyl)urea |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.552g/cm3 |
|---|---|
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23000 |
| Exact Mass | 215.03600 |
| PSA | 123.66000 |
| LogP | 2.37900 |
| Index of Refraction | 1.66 |
| InChIKey | ISCCNJYJZOFXNN-UHFFFAOYSA-N |
| SMILES | NC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 1 | |
CAS#:64-10-8
CAS#:556-89-8
CAS#:63-74-1
CAS#:67080-96-0![Acetamide,N-[(phenylamino)carbonyl] Structure](https://image.chemsrc.com/caspic/144/102-03-4.png)
CAS#:102-03-4
CAS#:67080-67-5![N-[4-Sulfamoyl-phenyl]-N'-[O,O-dimethyl-phosphono]-harnstoff Structure](https://image.chemsrc.com/caspic/102/15009-93-5.png)
CAS#:15009-93-5
CAS#:590-28-3
CAS#:40685-78-7
CAS#:91772-10-0
CAS#:87013-80-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-sulphamoylphenyl urea |
| N-<4-Sulfamoyl-phenyl>-harnstoff |
| N-Carbamoyl-sulfanilsaeure-amid |
| N-carbamoyl-sulfanilic acid amide |
| (4-Sulfamoyl-phenyl)-harnstoff |
| 4-[(aminocarbonyl)amino]-benzenesulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (4-sulfamoylphenyl)urea have? |
| A: English synonyms of (4-sulfamoylphenyl)urea: 4-sulphamoylphenyl urea, N--harnstoff, N-Carbamoyl-sulfanilsaeure-amid, N-carbamoyl-sulfanilic acid amide, (4-Sulfamoyl-phenyl)-harnstoff, 4-[(aminocarbonyl)amino]-benzenesulfonamide. |
| Q: What is the InChIKey of (4-sulfamoylphenyl)urea? |
| A: InChIKey of (4-sulfamoylphenyl)urea is ISCCNJYJZOFXNN-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of (4-sulfamoylphenyl)urea? |
| A: Polar surface area (PSA) of (4-sulfamoylphenyl)urea is 123.66000. |
| Q: What is the CAS number of (4-sulfamoylphenyl)urea? |
| A: CAS number of (4-sulfamoylphenyl)urea is 5657-41-0. |
| Q: What is the LogP of (4-sulfamoylphenyl)urea? |
| A: LogP of (4-sulfamoylphenyl)urea is 2.37900. |
| Q: What is the molecular formula of (4-sulfamoylphenyl)urea? |
| A: Molecular formula of (4-sulfamoylphenyl)urea is C7H9N3O3S. |
| Q: What is the molecular weight of (4-sulfamoylphenyl)urea? |
| A: Molecular weight of (4-sulfamoylphenyl)urea is 215.23000. |
| Q: What is the Chinese name of 5657-41-0? |
| A: Chinese name of 5657-41-0 is 5657-41-0. |
| Q: What are the upstream materials of (4-sulfamoylphenyl)urea? |
| A: Related upstream materials(CAS) of (4-sulfamoylphenyl)urea: 64-10-8;556-89-8;63-74-1;67080-96-0;102-03-4;67080-67-5;15009-93-5;590-28-3;40685-78-7;91772-10-0. |
| Q: What are the downstream products of (4-sulfamoylphenyl)urea? |
| A: Related downstream products(CAS) of (4-sulfamoylphenyl)urea: 87013-80-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |