Pregnane-11,20-dione,3,21-dihydroxy-, (3a,5b)- structure
|
Common Name | Pregnane-11,20-dione,3,21-dihydroxy-, (3a,5b)- | ||
|---|---|---|---|---|
| CAS Number | 566-03-0 | Molecular Weight | 348.47600 | |
| Density | 1.175g/cm3 | Boiling Point | 508.5ºC at 760mmHg | |
| Molecular Formula | C21H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.4ºC | |
Use of Pregnane-11,20-dione,3,21-dihydroxy-, (3a,5b)-Tetrahydro-11-dehydrocorticosterone is a 11β-HSD inhibitor[1]. |
| Name | 3-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| Synonym | More Synonyms |
| Description | Tetrahydro-11-dehydrocorticosterone is a 11β-HSD inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 508.5ºC at 760mmHg |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.47600 |
| Flash Point | 275.4ºC |
| Exact Mass | 348.23000 |
| PSA | 74.60000 |
| LogP | 2.74660 |
| Index of Refraction | 1.548 |
| InChIKey | XWYBFXIUISNTQG-RHBMFIQRSA-N |
| SMILES | CC12CC(=O)C3C(CCC4CC(O)CCC43C)C1CCC2C(=O)CO |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 5-B-PREGNANE-3-A-21-DIOL-11-20-DIONE |
| tetrahydro-11-dehydrocorticosterone |
| Tetrahydrodehydrocorticosterone |
| 3alpha,21-dihydroxy-5beta-pregnane-11,20-dione |
| tetrahydro-Kendall's A |