cholest-5-en-3β,7α-diol structure
|
Common Name | cholest-5-en-3β,7α-diol | ||
|---|---|---|---|---|
| CAS Number | 566-26-7 | Molecular Weight | 402.65300 | |
| Density | 1.03g/cm3 | Boiling Point | 515.3ºC at 760mmHg | |
| Molecular Formula | C27H46O2 | Melting Point | 168-170ºC | |
| MSDS | N/A | Flash Point | 214.7ºC | |
Use of cholest-5-en-3β,7α-diol7α-Hydroxycholesterol is a cholesterol oxide and is formed by both enzymatic and non-enzymatic oxidation. 7α-Hydroxycholesterol can be used as a biomarker for lipid peroxidation[1][2]. |
| Name | 7α-hydroxycholesterol |
|---|---|
| Synonym | More Synonyms |
| Description | 7α-Hydroxycholesterol is a cholesterol oxide and is formed by both enzymatic and non-enzymatic oxidation. 7α-Hydroxycholesterol can be used as a biomarker for lipid peroxidation[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 515.3ºC at 760mmHg |
| Melting Point | 168-170ºC |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.65300 |
| Flash Point | 214.7ºC |
| Exact Mass | 402.35000 |
| PSA | 40.46000 |
| LogP | 6.35950 |
| Index of Refraction | 1.536 |
| InChIKey | OYXZMSRRJOYLLO-RVOWOUOISA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3C(O)C=C4CC(O)CCC4(C)C3CCC12C |
| Storage condition | -20°C |
| 7|A-hydroxycholesterol |
| 7Alpha-Hydroxy Cholesterol |
| Cholest-5-en-3beta,7alpha-diol |
| Cholest-5-ene-3beta,7alpha-diol |
| (3S,7S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| 7alpha-hydroxycholesterol |
| 7alpha-Cholesterol |