2-Methyl-1-(4-nitrobenzyl)-1H-imidazole structure
|
Common Name | 2-Methyl-1-(4-nitrobenzyl)-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 56643-86-8 | Molecular Weight | 217.224 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 401.9±20.0 °C at 760 mmHg | |
| Molecular Formula | C11H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.9±21.8 °C | |
| Name | 2-Methyl-1-(4-nitrobenzyl)-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.9±20.0 °C at 760 mmHg |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.224 |
| Flash Point | 196.9±21.8 °C |
| Exact Mass | 217.085129 |
| PSA | 63.64000 |
| LogP | 1.38 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | KBZYPLFJZZWFAW-UHFFFAOYSA-N |
| SMILES | Cc1nccn1Cc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2933290090 |
|---|
|
~10%
2-Methyl-1-(4-n... CAS#:56643-86-8 |
| Literature: Merck Sharp and Dohme Limited Patent: US5298520 A1, 1994 ; US 5298520 A |
|
~%
2-Methyl-1-(4-n... CAS#:56643-86-8 |
| Literature: US6048884 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-1-(4-nitrobenzyl)-1H-imidazole |
| 2-methyl-1-[(4-nitrophenyl)methyl]imidazole |