9,10-Phenanthrenediimine structure
|
Common Name | 9,10-Phenanthrenediimine | ||
|---|---|---|---|---|
| CAS Number | 5665-52-1 | Molecular Weight | 206.24300 | |
| Density | 1.24g/cm3 | Boiling Point | 370.8ºC at 760 mmHg | |
| Molecular Formula | C14H10N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178ºC | |
| Name | Phenanthrene-9,10-diimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 370.8ºC at 760 mmHg |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.24300 |
| Flash Point | 178ºC |
| Exact Mass | 206.08400 |
| PSA | 47.70000 |
| LogP | 3.30240 |
| Index of Refraction | 1.687 |
| InChIKey | ASBFNPBREVZDOE-UHFFFAOYSA-N |
| SMILES | N=C1C(=N)c2ccccc2-c2ccccc21 |
| HS Code | 2925290090 |
|---|
|
~99%
9,10-Phenanthre... CAS#:5665-52-1 |
| Literature: Shaffer, David W.; Ryken, Scott A.; Zarkesh, Ryan A.; Heyduk, Alan F. Inorganic Chemistry, 2011 , vol. 50, # 1 p. 13 - 21 |
|
~%
9,10-Phenanthre... CAS#:5665-52-1 |
| Literature: v. Sommaruga Monatshefte fuer Chemie, 1880 , vol. 1, p. 158 |
|
~%
9,10-Phenanthre... CAS#:5665-52-1 |
| Literature: v. Sommaruga Monatshefte fuer Chemie, 1880 , vol. 1, p. 158 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| phenanthrene-9,10-dione-diimine |
| (9z,10e)-phenanthrene-9,10-diimine |
| 9,10-phenenthrenediimine |
| Phenanthrenchinon-diimid |
| 9,10-Phenanthrenediimine |
| Phenanthren-9,10-dion-diimin |
| 9,10-Phenantrnequinone diimine |
| phenanthrenequinonediimine |
| o-phenanthrenequinone diimine |