2,2'-Bis(Trifluoromethyl)-1,1'-Biphenyl structure
|
Common Name | 2,2'-Bis(Trifluoromethyl)-1,1'-Biphenyl | ||
|---|---|---|---|---|
| CAS Number | 567-15-7 | Molecular Weight | 290.20400 | |
| Density | 1.308g/cm3 | Boiling Point | 293.3ºC at 760mmHg | |
| Molecular Formula | C14H8F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.8ºC | |
| Name | 1-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 293.3ºC at 760mmHg |
| Molecular Formula | C14H8F6 |
| Molecular Weight | 290.20400 |
| Flash Point | 101.8ºC |
| Exact Mass | 290.05300 |
| LogP | 5.39120 |
| Index of Refraction | 1.46 |
| InChIKey | VBFVFTVNLQCICW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccccc1-c1ccccc1C(F)(F)F |
| HS Code | 3204170000 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,2'-bis(trifluoromethyl)benzidine |
| 2,2'-Bis-trifluormethyl-biphenyl |
| 2,2'-Bis(trifluoromethyl)biphenyl |
| 1,1'-Biphenyl,2,2'-bis(trifluoromethyl) |
| 2,2'-Bis(trifluoromethyl)-1,1'-biphenyl |