1,3,5-trichloro-2-(trifluoromethyl)benzene structure
|
Common Name | 1,3,5-trichloro-2-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 567-59-9 | Molecular Weight | 249.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2Cl3F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,5-trichloro-2-(trifluoromethyl)benzene |
|---|
| Molecular Formula | C7H2Cl3F3 |
|---|---|
| Molecular Weight | 249.44500 |
| Exact Mass | 247.91700 |
| LogP | 4.66560 |
| InChIKey | LNDDENGASVDXCV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1c(Cl)cc(Cl)cc1Cl |
| HS Code | 2903999090 |
|---|
|
~95%
1,3,5-trichloro... CAS#:567-59-9 |
| Literature: Castaner, J.; Riera, J.; Carilla, J.; Robert, A.; Molins, E.; Miravitlles, C. Journal of Organic Chemistry, 1991 , vol. 56, # 1 p. 103 - 110 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |