8-methoxy-2,3-dihydrocyclopenta[a]naphthalen-1-one structure
|
Common Name | 8-methoxy-2,3-dihydrocyclopenta[a]naphthalen-1-one | ||
|---|---|---|---|---|
| CAS Number | 5670-11-1 | Molecular Weight | 212.24400 | |
| Density | 1.225g/cm3 | Boiling Point | 386ºC at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186ºC | |
| Name | 8-methoxy-2,3-dihydrocyclopenta[a]naphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 386ºC at 760 mmHg |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 186ºC |
| Exact Mass | 212.08400 |
| PSA | 26.30000 |
| LogP | 2.97730 |
| Index of Refraction | 1.649 |
| InChIKey | ANJVCQXKYYAPFC-UHFFFAOYSA-N |
| SMILES | COc1ccc2ccc3c(c2c1)C(=O)CC3 |
|
~92%
8-methoxy-2,3-d... CAS#:5670-11-1 |
| Literature: Kundu Journal of Medicinal Chemistry, 1980 , vol. 23, # 5 p. 512 - 516 |
|
~%
8-methoxy-2,3-d... CAS#:5670-11-1 |
| Literature: Kundu Journal of Medicinal Chemistry, 1980 , vol. 23, # 5 p. 512 - 516 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| 8-methoxy-1-oxo-2,3-dihydro-1H-cyclopenta[a]naphthalene |